C20H17F2NO2 — CID 90576879
3,4-difluoro-N-[4-(2-prop-2-enylphenoxy)but-2-ynyl]benzamide (PubChem CID 90576879) has the molecular formula C20H17F2NO2 and a molecular weight of 341.36 g/mol. Its IUPAC name is 3,4-difluoro-N-[4-(2-prop-2-enylphenoxy)but-2-ynyl]benzamide.
| Compound Name | 3,4-difluoro-N-[4-(2-prop-2-enylphenoxy)but-2-ynyl]benzamide |
|---|---|
| PubChem CID | 90576879 |
| Molecular Formula | C20H17F2NO2 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 3,4-difluoro-N-[4-(2-prop-2-enylphenoxy)but-2-ynyl]benzamide |
| SMILES | C=CCc1ccccc1OCC#CCNC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H17F2NO2/c1-2-7-15-8-3-4-9-19(15)25-13-6-5-12-23-20(24)16-10-11-17(21)18(22)14-16/h2-4,8-11,14H,1,7,12-13H2,(H,23,24) |
| InChIKey | YJVUSCBSBSUFPX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|