C18H17N3O2 — CID 90576987
N-[4-(2-prop-2-enylphenoxy)but-2-ynyl]pyrazine-2-carboxamide (PubChem CID 90576987) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is N-[4-(2-prop-2-enylphenoxy)but-2-ynyl]pyrazine-2-carboxamide.
| Compound Name | N-[4-(2-prop-2-enylphenoxy)but-2-ynyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 90576987 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | N-[4-(2-prop-2-enylphenoxy)but-2-ynyl]pyrazine-2-carboxamide |
| SMILES | C=CCc1ccccc1OCC#CCNC(=O)c1cnccn1 |
| InChI | InChI=1S/C18H17N3O2/c1-2-7-15-8-3-4-9-17(15)23-13-6-5-10-21-18(22)16-14-19-11-12-20-16/h2-4,8-9,11-12,14H,1,7,10,13H2,(H,21,22) |
| InChIKey | KMUATWHYAUSDNU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|