C17H13F3N2O4S — CID 90553887
2-methyl-5-nitro-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]benzenesulfonamide (PubChem CID 90553887) has the molecular formula C17H13F3N2O4S and a molecular weight of 398.36 g/mol. Its IUPAC name is 2-methyl-5-nitro-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]benzenesulfonamide.
| Compound Name | 2-methyl-5-nitro-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90553887 |
| Molecular Formula | C17H13F3N2O4S |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 2-methyl-5-nitro-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]benzenesulfonamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)NCC#Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H13F3N2O4S/c1-12-8-9-14(22(23)24)11-16(12)27(25,26)21-10-4-6-13-5-2-3-7-15(13)17(18,19)20/h2-3,5,7-9,11,21H,10H2,1H3 |
| InChIKey | FUWGUPAIYBCWKL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|