C11H11Cl2NO2S — CID 56765741
N-but-3-ynyl-2,4-dichloro-5-methylbenzenesulfonamide (PubChem CID 56765741) has the molecular formula C11H11Cl2NO2S and a molecular weight of 292.19 g/mol. Its IUPAC name is N-but-3-ynyl-2,4-dichloro-5-methylbenzenesulfonamide.
| Compound Name | N-but-3-ynyl-2,4-dichloro-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 56765741 |
| Molecular Formula | C11H11Cl2NO2S |
| Molecular Weight | 292.19 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | N-but-3-ynyl-2,4-dichloro-5-methylbenzenesulfonamide |
| SMILES | C#CCCNS(=O)(=O)c1cc(C)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl2NO2S/c1-3-4-5-14-17(15,16)11-6-8(2)9(12)7-10(11)13/h1,6-7,14H,4-5H2,2H3 |
| InChIKey | FAAQEGJVBZWTQG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.19 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|