C15H12F3NO4S — CID 38750833
methyl 5-[[2-(trifluoromethoxy)phenyl]methylcarbamoyl]thiophene-2-carboxylate (PubChem CID 38750833) has the molecular formula C15H12F3NO4S and a molecular weight of 359.33 g/mol. Its IUPAC name is methyl 5-[[2-(trifluoromethoxy)phenyl]methylcarbamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[[2-(trifluoromethoxy)phenyl]methylcarbamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 38750833 |
| Molecular Formula | C15H12F3NO4S |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | methyl 5-[[2-(trifluoromethoxy)phenyl]methylcarbamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)NCc2ccccc2OC(F)(F)F)s1 |
| InChI | InChI=1S/C15H12F3NO4S/c1-22-14(21)12-7-6-11(24-12)13(20)19-8-9-4-2-3-5-10(9)23-15(16,17)18/h2-7H,8H2,1H3,(H,19,20) |
| InChIKey | GJAMLASFHAXTOR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |