C16H15F3N2O4S — CID 41479006
4-(methanesulfonamido)-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide (PubChem CID 41479006) has the molecular formula C16H15F3N2O4S and a molecular weight of 388.37 g/mol. Its IUPAC name is 4-(methanesulfonamido)-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide.
| Compound Name | 4-(methanesulfonamido)-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 41479006 |
| Molecular Formula | C16H15F3N2O4S |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 4-(methanesulfonamido)-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)NCc2ccccc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H15F3N2O4S/c1-26(23,24)21-13-8-6-11(7-9-13)15(22)20-10-12-4-2-3-5-14(12)25-16(17,18)19/h2-9,21H,10H2,1H3,(H,20,22) |
| InChIKey | GISUQWFNEWLGLO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |