C15H12F3NO2S — CID 162582853
4-sulfanyl-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide (PubChem CID 162582853) has the molecular formula C15H12F3NO2S and a molecular weight of 327.33 g/mol. Its IUPAC name is 4-sulfanyl-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide.
| Compound Name | 4-sulfanyl-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 162582853 |
| Molecular Formula | C15H12F3NO2S |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 4-sulfanyl-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccccc1OC(F)(F)F)c1ccc(S)cc1 |
| InChI | InChI=1S/C15H12F3NO2S/c16-15(17,18)21-13-4-2-1-3-11(13)9-19-14(20)10-5-7-12(22)8-6-10/h1-8,22H,9H2,(H,19,20) |
| InChIKey | SCCQIQPMBTWPTE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|