C17H15ClF3NO4 — CID 112804201
3-chloro-5-ethoxy-4-hydroxy-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide (PubChem CID 112804201) has the molecular formula C17H15ClF3NO4 and a molecular weight of 389.76 g/mol. Its IUPAC name is 3-chloro-5-ethoxy-4-hydroxy-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide.
| Compound Name | 3-chloro-5-ethoxy-4-hydroxy-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 112804201 |
| Molecular Formula | C17H15ClF3NO4 |
| Molecular Weight | 389.76 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 3-chloro-5-ethoxy-4-hydroxy-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide |
| SMILES | CCOc1cc(C(=O)NCc2ccccc2OC(F)(F)F)cc(Cl)c1O |
| InChI | InChI=1S/C17H15ClF3NO4/c1-2-25-14-8-11(7-12(18)15(14)23)16(24)22-9-10-5-3-4-6-13(10)26-17(19,20)21/h3-8,23H,2,9H2,1H3,(H,22,24) |
| InChIKey | YBDSJHWQWNNJFP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.76 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |