C18H20F3N3O2S — CID 118112508
5-(piperazin-1-ylmethyl)-N-[[2-(trifluoromethoxy)phenyl]methyl]thiophene-2-carboxamide (PubChem CID 118112508) has the molecular formula C18H20F3N3O2S and a molecular weight of 399.44 g/mol. Its IUPAC name is 5-(piperazin-1-ylmethyl)-N-[[2-(trifluoromethoxy)phenyl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-(piperazin-1-ylmethyl)-N-[[2-(trifluoromethoxy)phenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 118112508 |
| Molecular Formula | C18H20F3N3O2S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 5-(piperazin-1-ylmethyl)-N-[[2-(trifluoromethoxy)phenyl]methyl]thiophene-2-carboxamide |
| SMILES | O=C(NCc1ccccc1OC(F)(F)F)c1ccc(CN2CCNCC2)s1 |
| InChI | InChI=1S/C18H20F3N3O2S/c19-18(20,21)26-15-4-2-1-3-13(15)11-23-17(25)16-6-5-14(27-16)12-24-9-7-22-8-10-24/h1-6,22H,7-12H2,(H,23,25) |
| InChIKey | SIWNDRZDGFKMCC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |