C19H19BrN4O3S — CID 55702442
2-[(4-bromophenyl)sulfonyl-methylamino]-N-[(1-phenylpyrazol-4-yl)methyl]acetamide (PubChem CID 55702442) has the molecular formula C19H19BrN4O3S and a molecular weight of 463.36 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonyl-methylamino]-N-[(1-phenylpyrazol-4-yl)methyl]acetamide.
| Compound Name | 2-[(4-bromophenyl)sulfonyl-methylamino]-N-[(1-phenylpyrazol-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 55702442 |
| Molecular Formula | C19H19BrN4O3S |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonyl-methylamino]-N-[(1-phenylpyrazol-4-yl)methyl]acetamide |
| SMILES | CN(CC(=O)NCc1cnn(-c2ccccc2)c1)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H19BrN4O3S/c1-23(28(26,27)18-9-7-16(20)8-10-18)14-19(25)21-11-15-12-22-24(13-15)17-5-3-2-4-6-17/h2-10,12-13H,11,14H2,1H3,(H,21,25) |
| InChIKey | WXGUHGDESKUDGJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |