C16H20N2O2S — CID 90168120
N,N-diethyl-4-(2-methyl-3-pyridinyl)benzenesulfonamide (PubChem CID 90168120) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is N,N-diethyl-4-(2-methyl-3-pyridinyl)benzenesulfonamide.
| Compound Name | N,N-diethyl-4-(2-methyl-3-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90168120 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N,N-diethyl-4-(2-methyl-3-pyridinyl)benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(-c2cccnc2C)cc1 |
| InChI | InChI=1S/C16H20N2O2S/c1-4-18(5-2)21(19,20)15-10-8-14(9-11-15)16-7-6-12-17-13(16)3/h6-12H,4-5H2,1-3H3 |
| InChIKey | CHULRYIVJSUPCO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |