C21H22FN3O4S — CID 33428902
3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]propanamide (PubChem CID 33428902) has the molecular formula C21H22FN3O4S and a molecular weight of 431.49 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]propanamide.
| Compound Name | 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 33428902 |
| Molecular Formula | C21H22FN3O4S |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)CCc2ncc(-c3ccc(F)cc3)o2)cc1 |
| InChI | InChI=1S/C21H22FN3O4S/c1-15-2-8-18(9-3-15)30(27,28)25-13-12-23-20(26)10-11-21-24-14-19(29-21)16-4-6-17(22)7-5-16/h2-9,14,25H,10-13H2,1H3,(H,23,26) |
| InChIKey | CYTCBAQYHSJVCN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|