C35H37ClN6O5S — CID 88571290
2-[1-[(4-chlorophenoxy)methyl]-5-methoxy-2-methylindol-3-yl]-N-[2-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]ethyl]acetamide (PubChem CID 88571290) has the molecular formula C35H37ClN6O5S and a molecular weight of 689.24 g/mol. Its IUPAC name is 2-[1-[(4-chlorophenoxy)methyl]-5-methoxy-2-methylindol-3-yl]-N-[2-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]ethyl]acetamide.
| Compound Name | 2-[1-[(4-chlorophenoxy)methyl]-5-methoxy-2-methylindol-3-yl]-N-[2-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 88571290 |
| Molecular Formula | C35H37ClN6O5S |
| Molecular Weight | 689.24 g/mol |
| Exact Mass | 688.22 |
| IUPAC Name | 2-[1-[(4-chlorophenoxy)methyl]-5-methoxy-2-methylindol-3-yl]-N-[2-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]ethyl]acetamide |
| SMILES | COc1ccc2c(c1)c(CC(=O)NCCNS(=O)(=O)c1ccc(/N=N/c3ccc(N(C)C)cc3)cc1)c(C)n2COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C35H37ClN6O5S/c1-24-32(33-21-30(46-4)15-18-34(33)42(24)23-47-29-13-5-25(36)6-14-29)22-35(43)37-19-20-38-48(44,45)31-16-9-27(10-17-31)40-39-26-7-11-28(12-8-26)41(2)3/h5-18,21,38H,19-20,22-23H2,1-4H3,(H,37,43)/b40-39+ |
| InChIKey | KOYUAWQESMFWNR-XQQUEIPISA-N |
| XLogP | 6.77 |
| TPSA | 126.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.24 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|