C36H37ClN6O5S — CID 59342844
2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-N-[3-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]propyl]acetamide (PubChem CID 59342844) has the molecular formula C36H37ClN6O5S and a molecular weight of 701.25 g/mol. Its IUPAC name is 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-N-[3-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]propyl]acetamide.
| Compound Name | 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-N-[3-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]propyl]acetamide |
|---|---|
| PubChem CID | 59342844 |
| Molecular Formula | C36H37ClN6O5S |
| Molecular Weight | 701.25 g/mol |
| Exact Mass | 700.22 |
| IUPAC Name | 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-N-[3-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]propyl]acetamide |
| SMILES | COc1ccc2c(c1)c(CC(=O)NCCCNS(=O)(=O)c1ccc(/N=N/c3ccc(N(C)C)cc3)cc1)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C36H37ClN6O5S/c1-24-32(33-22-30(48-4)16-19-34(33)43(24)36(45)25-6-8-26(37)9-7-25)23-35(44)38-20-5-21-39-49(46,47)31-17-12-28(13-18-31)41-40-27-10-14-29(15-11-27)42(2)3/h6-19,22,39H,5,20-21,23H2,1-4H3,(H,38,44)/b41-40+ |
| InChIKey | YJWPCHNRQZSDCD-CDJCAARLSA-N |
| XLogP | 6.81 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.25 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|