C14H22FN2O5P — CID 118325913
[4-[2-(6-aminohexylamino)-1-fluoro-2-oxoethyl]phenyl] dihydrogen phosphate (PubChem CID 118325913) has the molecular formula C14H22FN2O5P and a molecular weight of 348.31 g/mol. Its IUPAC name is [4-[2-(6-aminohexylamino)-1-fluoro-2-oxoethyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[2-(6-aminohexylamino)-1-fluoro-2-oxoethyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 118325913 |
| Molecular Formula | C14H22FN2O5P |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | [4-[2-(6-aminohexylamino)-1-fluoro-2-oxoethyl]phenyl] dihydrogen phosphate |
| SMILES | NCCCCCCNC(=O)C(F)c1ccc(OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C14H22FN2O5P/c15-13(14(18)17-10-4-2-1-3-9-16)11-5-7-12(8-6-11)22-23(19,20)21/h5-8,13H,1-4,9-10,16H2,(H,17,18)(H2,19,20,21) |
| InChIKey | GFXDOPYAJNOBAD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|