C23H38FN2O9P — CID 101233220
tert-butyl N-[2-[2-[2-[[2-(4-diethoxyphosphoryloxyphenyl)-2-fluoroacetyl]amino]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 101233220) has the molecular formula C23H38FN2O9P and a molecular weight of 536.53 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[[2-(4-diethoxyphosphoryloxyphenyl)-2-fluoroacetyl]amino]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[[2-(4-diethoxyphosphoryloxyphenyl)-2-fluoroacetyl]amino]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 101233220 |
| Molecular Formula | C23H38FN2O9P |
| Molecular Weight | 536.53 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[[2-(4-diethoxyphosphoryloxyphenyl)-2-fluoroacetyl]amino]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CCOP(=O)(OCC)Oc1ccc(C(F)C(=O)NCCOCCOCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H38FN2O9P/c1-6-32-36(29,33-7-2)35-19-10-8-18(9-11-19)20(24)21(27)25-12-14-30-16-17-31-15-13-26-22(28)34-23(3,4)5/h8-11,20H,6-7,12-17H2,1-5H3,(H,25,27)(H,26,28) |
| InChIKey | ROSRHZNMJVMBPM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|