C17H27ClNO5P — CID 19090866
tert-butyl N-[2-(4-chlorophenyl)-3-[ethoxy(methyl)phosphoryl]-3-hydroxypropyl]carbamate (PubChem CID 19090866) has the molecular formula C17H27ClNO5P and a molecular weight of 391.83 g/mol. Its IUPAC name is tert-butyl N-[2-(4-chlorophenyl)-3-[ethoxy(methyl)phosphoryl]-3-hydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-chlorophenyl)-3-[ethoxy(methyl)phosphoryl]-3-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 19090866 |
| Molecular Formula | C17H27ClNO5P |
| Molecular Weight | 391.83 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | tert-butyl N-[2-(4-chlorophenyl)-3-[ethoxy(methyl)phosphoryl]-3-hydroxypropyl]carbamate |
| SMILES | CCOP(C)(=O)C(O)C(CNC(=O)OC(C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H27ClNO5P/c1-6-23-25(5,22)15(20)14(12-7-9-13(18)10-8-12)11-19-16(21)24-17(2,3)4/h7-10,14-15,20H,6,11H2,1-5H3,(H,19,21) |
| InChIKey | PTTHDLXEMCIECT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.83 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|