C18H27ClN2O3 — CID 20814870
tert-butyl N-[1-[(4-chlorobenzoyl)amino]-4-methylpentan-2-yl]carbamate (PubChem CID 20814870) has the molecular formula C18H27ClN2O3 and a molecular weight of 354.88 g/mol. Its IUPAC name is tert-butyl N-[1-[(4-chlorobenzoyl)amino]-4-methylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(4-chlorobenzoyl)amino]-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 20814870 |
| Molecular Formula | C18H27ClN2O3 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | tert-butyl N-[1-[(4-chlorobenzoyl)amino]-4-methylpentan-2-yl]carbamate |
| SMILES | CC(C)CC(CNC(=O)c1ccc(Cl)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27ClN2O3/c1-12(2)10-15(21-17(23)24-18(3,4)5)11-20-16(22)13-6-8-14(19)9-7-13/h6-9,12,15H,10-11H2,1-5H3,(H,20,22)(H,21,23) |
| InChIKey | GKKZDNKEWPTOJQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |