C23H30Cl2NO4P — CID 19040300
tert-butyl N-[1-bis(4-chlorophenyl)phosphoryl-1-hydroxy-4-methylpentan-2-yl]carbamate (PubChem CID 19040300) has the molecular formula C23H30Cl2NO4P and a molecular weight of 486.38 g/mol. Its IUPAC name is tert-butyl N-[1-bis(4-chlorophenyl)phosphoryl-1-hydroxy-4-methylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-bis(4-chlorophenyl)phosphoryl-1-hydroxy-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 19040300 |
| Molecular Formula | C23H30Cl2NO4P |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | tert-butyl N-[1-bis(4-chlorophenyl)phosphoryl-1-hydroxy-4-methylpentan-2-yl]carbamate |
| SMILES | CC(C)CC(NC(=O)OC(C)(C)C)C(O)P(=O)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H30Cl2NO4P/c1-15(2)14-20(26-22(28)30-23(3,4)5)21(27)31(29,18-10-6-16(24)7-11-18)19-12-8-17(25)9-13-19/h6-13,15,20-21,27H,14H2,1-5H3,(H,26,28) |
| InChIKey | LUAXXZBIHWMEBF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|