C21H35N3O3 — CID 110627490
tert-butyl N-[1-[[2-(dimethylamino)-2-phenylacetyl]amino]-4-methylpentan-2-yl]carbamate (PubChem CID 110627490) has the molecular formula C21H35N3O3 and a molecular weight of 377.53 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(dimethylamino)-2-phenylacetyl]amino]-4-methylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(dimethylamino)-2-phenylacetyl]amino]-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 110627490 |
| Molecular Formula | C21H35N3O3 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | tert-butyl N-[1-[[2-(dimethylamino)-2-phenylacetyl]amino]-4-methylpentan-2-yl]carbamate |
| SMILES | CC(C)CC(CNC(=O)C(c1ccccc1)N(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H35N3O3/c1-15(2)13-17(23-20(26)27-21(3,4)5)14-22-19(25)18(24(6)7)16-11-9-8-10-12-16/h8-12,15,17-18H,13-14H2,1-7H3,(H,22,25)(H,23,26) |
| InChIKey | HEPSGHGAVXFQGG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |