C26H40N4O4 — CID 18044442
tert-butyl N-[1-[cyanomethyl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18044442) has the molecular formula C26H40N4O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is tert-butyl N-[1-[cyanomethyl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[cyanomethyl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18044442 |
| Molecular Formula | C26H40N4O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | tert-butyl N-[1-[cyanomethyl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(c1ccccc1)N(CC#N)C(=O)C(CC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H40N4O4/c1-7-8-12-16-28-23(31)22(20-13-10-9-11-14-20)30(17-15-27)24(32)21(18-19(2)3)29-25(33)34-26(4,5)6/h9-11,13-14,19,21-22H,7-8,12,16-18H2,1-6H3,(H,28,31)(H,29,33) |
| InChIKey | KQNMKNUNQLUMJH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|