C23H34N4O4 — CID 18010242
tert-butyl N-[1-[cyanomethyl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 18010242) has the molecular formula C23H34N4O4 and a molecular weight of 430.55 g/mol. Its IUPAC name is tert-butyl N-[1-[cyanomethyl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[cyanomethyl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18010242 |
| Molecular Formula | C23H34N4O4 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | tert-butyl N-[1-[cyanomethyl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(c1ccccc1)N(CC#N)C(=O)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H34N4O4/c1-6-7-11-15-25-20(28)19(18-12-9-8-10-13-18)27(16-14-24)21(29)17(2)26-22(30)31-23(3,4)5/h8-10,12-13,17,19H,6-7,11,15-16H2,1-5H3,(H,25,28)(H,26,30) |
| InChIKey | MATQNFYLCRZQSC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|