C24H36N4O4 — CID 18010405
tert-butyl N-[1-[[2-(butylamino)-1-(3,5-dimethylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-1-oxopropan-2-yl]carbamate (PubChem CID 18010405) has the molecular formula C24H36N4O4 and a molecular weight of 444.58 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(butylamino)-1-(3,5-dimethylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(butylamino)-1-(3,5-dimethylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18010405 |
| Molecular Formula | C24H36N4O4 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | tert-butyl N-[1-[[2-(butylamino)-1-(3,5-dimethylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCNC(=O)C(c1cc(C)cc(C)c1)N(CC#N)C(=O)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H36N4O4/c1-8-9-11-26-21(29)20(19-14-16(2)13-17(3)15-19)28(12-10-25)22(30)18(4)27-23(31)32-24(5,6)7/h13-15,18,20H,8-9,11-12H2,1-7H3,(H,26,29)(H,27,31) |
| InChIKey | VXOCPSQENYEQTD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|