C25H38N4O4S — CID 18056006
tert-butyl N-[1-[cyanomethyl-[1-(3,5-dimethylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18056006) has the molecular formula C25H38N4O4S and a molecular weight of 490.67 g/mol. Its IUPAC name is tert-butyl N-[1-[cyanomethyl-[1-(3,5-dimethylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[cyanomethyl-[1-(3,5-dimethylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18056006 |
| Molecular Formula | C25H38N4O4S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | tert-butyl N-[1-[cyanomethyl-[1-(3,5-dimethylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | CCCC(C)NC(=O)C(c1cc(C)cc(C)c1)N(CC#N)C(=O)C(CS)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H38N4O4S/c1-8-9-18(4)27-22(30)21(19-13-16(2)12-17(3)14-19)29(11-10-26)23(31)20(15-34)28-24(32)33-25(5,6)7/h12-14,18,20-21,34H,8-9,11,15H2,1-7H3,(H,27,30)(H,28,32) |
| InChIKey | QLTGGTNCFUXRPP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|