C22H32N4O4S — CID 18055883
tert-butyl N-[1-[cyanomethyl-[1-(3-methylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18055883) has the molecular formula C22H32N4O4S and a molecular weight of 448.59 g/mol. Its IUPAC name is tert-butyl N-[1-[cyanomethyl-[1-(3-methylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[cyanomethyl-[1-(3-methylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18055883 |
| Molecular Formula | C22H32N4O4S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | tert-butyl N-[1-[cyanomethyl-[1-(3-methylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | Cc1cccc(C(C(=O)NC(C)C)N(CC#N)C(=O)C(CS)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C22H32N4O4S/c1-14(2)24-19(27)18(16-9-7-8-15(3)12-16)26(11-10-23)20(28)17(13-31)25-21(29)30-22(4,5)6/h7-9,12,14,17-18,31H,11,13H2,1-6H3,(H,24,27)(H,25,29) |
| InChIKey | AWNBOSLOIYAQST-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|