C23H37N3O4 — CID 18009672
tert-butyl N-[1-[ethyl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 18009672) has the molecular formula C23H37N3O4 and a molecular weight of 419.57 g/mol. Its IUPAC name is tert-butyl N-[1-[ethyl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[ethyl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18009672 |
| Molecular Formula | C23H37N3O4 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | tert-butyl N-[1-[ethyl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(c1ccccc1)N(CC)C(=O)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H37N3O4/c1-7-9-13-16-24-20(27)19(18-14-11-10-12-15-18)26(8-2)21(28)17(3)25-22(29)30-23(4,5)6/h10-12,14-15,17,19H,7-9,13,16H2,1-6H3,(H,24,27)(H,25,29) |
| InChIKey | MTKDDQHLCQJDTM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|