C26H43N3O4 — CID 18013662
tert-butyl N-[1-[2-methylbutan-2-yl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 18013662) has the molecular formula C26H43N3O4 and a molecular weight of 461.65 g/mol. Its IUPAC name is tert-butyl N-[1-[2-methylbutan-2-yl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-methylbutan-2-yl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18013662 |
| Molecular Formula | C26H43N3O4 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.33 |
| IUPAC Name | tert-butyl N-[1-[2-methylbutan-2-yl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(c1ccccc1)N(C(=O)C(C)NC(=O)OC(C)(C)C)C(C)(C)CC |
| InChI | InChI=1S/C26H43N3O4/c1-9-11-15-18-27-22(30)21(20-16-13-12-14-17-20)29(26(7,8)10-2)23(31)19(3)28-24(32)33-25(4,5)6/h12-14,16-17,19,21H,9-11,15,18H2,1-8H3,(H,27,30)(H,28,32) |
| InChIKey | ZVBHYEHCGIUFLZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|