C24H39N3O4 — CID 18038170
tert-butyl N-[1-[[2-(butylamino)-2-oxo-1-phenylethyl]-ethylamino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 18038170) has the molecular formula C24H39N3O4 and a molecular weight of 433.59 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(butylamino)-2-oxo-1-phenylethyl]-ethylamino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(butylamino)-2-oxo-1-phenylethyl]-ethylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18038170 |
| Molecular Formula | C24H39N3O4 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | tert-butyl N-[1-[[2-(butylamino)-2-oxo-1-phenylethyl]-ethylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCCCNC(=O)C(c1ccccc1)N(CC)C(=O)C(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C24H39N3O4/c1-8-10-16-25-21(28)20(18-14-12-11-13-15-18)27(9-2)22(29)19(17(3)4)26-23(30)31-24(5,6)7/h11-15,17,19-20H,8-10,16H2,1-7H3,(H,25,28)(H,26,30) |
| InChIKey | NUTLNIRALQSCTJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|