C24H39N3O5 — CID 18011142
tert-butyl N-[1-[2-hydroxyethyl-[1-(3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 18011142) has the molecular formula C24H39N3O5 and a molecular weight of 449.59 g/mol. Its IUPAC name is tert-butyl N-[1-[2-hydroxyethyl-[1-(3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-hydroxyethyl-[1-(3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18011142 |
| Molecular Formula | C24H39N3O5 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | tert-butyl N-[1-[2-hydroxyethyl-[1-(3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(c1cccc(C)c1)N(CCO)C(=O)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H39N3O5/c1-7-8-9-13-25-21(29)20(19-12-10-11-17(2)16-19)27(14-15-28)22(30)18(3)26-23(31)32-24(4,5)6/h10-12,16,18,20,28H,7-9,13-15H2,1-6H3,(H,25,29)(H,26,31) |
| InChIKey | ICLCPIIPGKAPAA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|