C30H49N3O6 — CID 18049012
methyl 2-[[2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-octylamino]-2-phenylacetyl]amino]acetate (PubChem CID 18049012) has the molecular formula C30H49N3O6 and a molecular weight of 547.74 g/mol. Its IUPAC name is methyl 2-[[2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-octylamino]-2-phenylacetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-octylamino]-2-phenylacetyl]amino]acetate |
|---|---|
| PubChem CID | 18049012 |
| Molecular Formula | C30H49N3O6 |
| Molecular Weight | 547.74 g/mol |
| Exact Mass | 547.36 |
| IUPAC Name | methyl 2-[[2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-octylamino]-2-phenylacetyl]amino]acetate |
| SMILES | CCCCCCCCN(C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)C(C(=O)NCC(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C30H49N3O6/c1-8-9-10-11-12-16-19-33(28(36)24(20-22(2)3)32-29(37)39-30(4,5)6)26(23-17-14-13-15-18-23)27(35)31-21-25(34)38-7/h13-15,17-18,22,24,26H,8-12,16,19-21H2,1-7H3,(H,31,35)(H,32,37) |
| InChIKey | SDRCSCWQPSGVDX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.74 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|