C30H51N3O4 — CID 18048146
tert-butyl N-[1-[hexyl-[2-oxo-2-(pentan-2-ylamino)-1-phenylethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18048146) has the molecular formula C30H51N3O4 and a molecular weight of 517.76 g/mol. Its IUPAC name is tert-butyl N-[1-[hexyl-[2-oxo-2-(pentan-2-ylamino)-1-phenylethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[hexyl-[2-oxo-2-(pentan-2-ylamino)-1-phenylethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18048146 |
| Molecular Formula | C30H51N3O4 |
| Molecular Weight | 517.76 g/mol |
| Exact Mass | 517.39 |
| IUPAC Name | tert-butyl N-[1-[hexyl-[2-oxo-2-(pentan-2-ylamino)-1-phenylethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCCCCCN(C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)C(C(=O)NC(C)CCC)c1ccccc1 |
| InChI | InChI=1S/C30H51N3O4/c1-9-11-12-16-20-33(28(35)25(21-22(3)4)32-29(36)37-30(6,7)8)26(24-18-14-13-15-19-24)27(34)31-23(5)17-10-2/h13-15,18-19,22-23,25-26H,9-12,16-17,20-21H2,1-8H3,(H,31,34)(H,32,36) |
| InChIKey | FZIBUCRLVULDFU-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.76 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|