C22H28NO7P — CID 121274883
tert-butyl N-[2-[(E)-2-diphenoxyphosphoryloxyprop-1-enoxy]ethyl]carbamate (PubChem CID 121274883) has the molecular formula C22H28NO7P and a molecular weight of 449.44 g/mol. Its IUPAC name is tert-butyl N-[2-[(E)-2-diphenoxyphosphoryloxyprop-1-enoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(E)-2-diphenoxyphosphoryloxyprop-1-enoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 121274883 |
| Molecular Formula | C22H28NO7P |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | tert-butyl N-[2-[(E)-2-diphenoxyphosphoryloxyprop-1-enoxy]ethyl]carbamate |
| SMILES | C/C(=C\OCCNC(=O)OC(C)(C)C)OP(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C22H28NO7P/c1-18(17-26-16-15-23-21(24)27-22(2,3)4)28-31(25,29-19-11-7-5-8-12-19)30-20-13-9-6-10-14-20/h5-14,17H,15-16H2,1-4H3,(H,23,24)/b18-17+ |
| InChIKey | BEIPDKWUDXCQSX-ISLYRVAYSA-N |
| XLogP | 5.67 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|