C21H25N4O6P — CID 166482359
tert-butyl N-[[2-(diphenoxyphosphoryloxymethyl)triazol-4-yl]methyl]carbamate (PubChem CID 166482359) has the molecular formula C21H25N4O6P and a molecular weight of 460.43 g/mol. Its IUPAC name is tert-butyl N-[[2-(diphenoxyphosphoryloxymethyl)triazol-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-(diphenoxyphosphoryloxymethyl)triazol-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 166482359 |
| Molecular Formula | C21H25N4O6P |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | tert-butyl N-[[2-(diphenoxyphosphoryloxymethyl)triazol-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cnn(COP(=O)(Oc2ccccc2)Oc2ccccc2)n1 |
| InChI | InChI=1S/C21H25N4O6P/c1-21(2,3)29-20(26)22-14-17-15-23-25(24-17)16-28-32(27,30-18-10-6-4-7-11-18)31-19-12-8-5-9-13-19/h4-13,15H,14,16H2,1-3H3,(H,22,26) |
| InChIKey | YZMXKHOHYIERGR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|