About tert-butyl N-[[2-[[(2S,3S)-3-methyl-4-oxoazetidin-2-yl]methyl]triazol-4-yl]methyl]carbamate
tert-butyl N-[[2-[[(2S,3S)-3-methyl-4-oxoazetidin-2-yl]methyl]triazol-4-yl]methyl]carbamate (PubChem CID 118390224) has the molecular formula C13H21N5O3
and a molecular weight of 295.34 g/mol. Its IUPAC name is tert-butyl N-[[2-[[(2S,3S)-3-methyl-4-oxoazetidin-2-yl]methyl]triazol-4-yl]methyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[[2-[[(2S,3S)-3-methyl-4-oxoazetidin-2-yl]methyl]triazol-4-yl]methyl]carbamate |
| PubChem CID | 118390224 |
| Molecular Formula | C13H21N5O3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | tert-butyl N-[[2-[[(2S,3S)-3-methyl-4-oxoazetidin-2-yl]methyl]triazol-4-yl]methyl]carbamate |
| SMILES | C[C@@H]1C(=O)N[C@@H]1Cn1ncc(CNC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C13H21N5O3/c1-8-10(16-11(8)19)7-18-15-6-9(17-18)5-14-12(20)21-13(2,3)4/h6,8,10H,5,7H2,1-4H3,(H,14,20)(H,16,19)/t8-,10+/m0/s1 |
| InChIKey | XWOFCMSAWPFBOD-WCBMZHEXSA-N |
| XLogP | 0.44 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[[2-[[(2S,3S)-3-methyl-4-oxoazetidin-2-yl]methyl]triazol-4-yl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[[2-[[(2S,3S)-3-methyl-4-oxoazetidin-2-yl]methyl]triazol-4-yl]methyl]carbamate?
The IUPAC name of tert-butyl N-[[2-[[(2S,3S)-3-methyl-4-oxoazetidin-2-yl]methyl]triazol-4-yl]methyl]carbamate (CID 118390224) is tert-butyl N-[[2-[[(2S,3S)-3-methyl-4-oxoazetidin-2-yl]methyl]triazol-4-yl]methyl]carbamate.
What is the SMILES notation for tert-butyl N-[[2-[[(2S,3S)-3-methyl-4-oxoazetidin-2-yl]methyl]triazol-4-yl]methyl]carbamate?
The canonical SMILES for tert-butyl N-[[2-[[(2S,3S)-3-methyl-4-oxoazetidin-2-yl]methyl]triazol-4-yl]methyl]carbamate is C[C@@H]1C(=O)N[C@@H]1Cn1ncc(CNC(=O)OC(C)(C)C)n1.
What is the InChIKey of tert-butyl N-[[2-[[(2S,3S)-3-methyl-4-oxoazetidin-2-yl]methyl]triazol-4-yl]methyl]carbamate?
The InChIKey is XWOFCMSAWPFBOD-WCBMZHEXSA-N. The full InChI is InChI=1S/C13H21N5O3/c1-8-10(16-11(8)19)7-18-15-6-9(17-18)5-14-12(20)21-13(2,3)4/h6,8,10H,5,7H2,1-4H3,(H,14,20)(H,16,19)/t8-,10+/m0/s1.
What are the key properties of tert-butyl N-[[2-[[(2S,3S)-3-methyl-4-oxoazetidin-2-yl]methyl]triazol-4-yl]methyl]carbamate?
tert-butyl N-[[2-[[(2S,3S)-3-methyl-4-oxoazetidin-2-yl]methyl]triazol-4-yl]methyl]carbamate has a molecular weight of 295.34 g/mol, XLogP of 0.44, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[[2-[[(2S,3S)-3-methyl-4-oxoazetidin-2-yl]methyl]triazol-4-yl]methyl]carbamate is sourced from PubChem (CID 118390224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).