C18H22NO7PS — CID 114986713
tert-butyl N-(diphenoxyphosphorylmethylsulfonyl)carbamate (PubChem CID 114986713) has the molecular formula C18H22NO7PS and a molecular weight of 427.42 g/mol. Its IUPAC name is tert-butyl N-(diphenoxyphosphorylmethylsulfonyl)carbamate.
| Compound Name | tert-butyl N-(diphenoxyphosphorylmethylsulfonyl)carbamate |
|---|---|
| PubChem CID | 114986713 |
| Molecular Formula | C18H22NO7PS |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | tert-butyl N-(diphenoxyphosphorylmethylsulfonyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)CP(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C18H22NO7PS/c1-18(2,3)24-17(20)19-28(22,23)14-27(21,25-15-10-6-4-7-11-15)26-16-12-8-5-9-13-16/h4-13H,14H2,1-3H3,(H,19,20) |
| InChIKey | NNJOVHODLPDWOM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|