C12H18NO4P — CID 54530386
benzyl-N-[(2-methylpropan-2-yl)oxycarbonyl]phosphonamidic acid (PubChem CID 54530386) has the molecular formula C12H18NO4P and a molecular weight of 271.25 g/mol. Its IUPAC name is benzyl-N-[(2-methylpropan-2-yl)oxycarbonyl]phosphonamidic acid.
| Compound Name | benzyl-N-[(2-methylpropan-2-yl)oxycarbonyl]phosphonamidic acid |
|---|---|
| PubChem CID | 54530386 |
| Molecular Formula | C12H18NO4P |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | benzyl-N-[(2-methylpropan-2-yl)oxycarbonyl]phosphonamidic acid |
| SMILES | CC(C)(C)OC(=O)NP(=O)(O)Cc1ccccc1 |
| InChI | InChI=1S/C12H18NO4P/c1-12(2,3)17-11(14)13-18(15,16)9-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | YWCKISSLBRKGRH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|