C12H19N3O2 — CID 69172873
tert-butyl N-(2-benzylhydrazinyl)carbamate (PubChem CID 69172873) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is tert-butyl N-(2-benzylhydrazinyl)carbamate.
| Compound Name | tert-butyl N-(2-benzylhydrazinyl)carbamate |
|---|---|
| PubChem CID | 69172873 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | tert-butyl N-(2-benzylhydrazinyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NNNCc1ccccc1 |
| InChI | InChI=1S/C12H19N3O2/c1-12(2,3)17-11(16)14-15-13-9-10-7-5-4-6-8-10/h4-8,13,15H,9H2,1-3H3,(H,14,16) |
| InChIKey | WUISIRGLFSVZSP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|