C23H31N3O11P2 — CID 163798566
tert-butyl N-[2-[[2-[2-[diphenoxyphosphoryloxy(hydroxy)phosphoryl]oxyethylamino]-2-oxoethyl]amino]-2-oxoethyl]carbamate (PubChem CID 163798566) has the molecular formula C23H31N3O11P2 and a molecular weight of 587.46 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-[2-[diphenoxyphosphoryloxy(hydroxy)phosphoryl]oxyethylamino]-2-oxoethyl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-[2-[diphenoxyphosphoryloxy(hydroxy)phosphoryl]oxyethylamino]-2-oxoethyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 163798566 |
| Molecular Formula | C23H31N3O11P2 |
| Molecular Weight | 587.46 g/mol |
| Exact Mass | 587.14 |
| IUPAC Name | tert-butyl N-[2-[[2-[2-[diphenoxyphosphoryloxy(hydroxy)phosphoryl]oxyethylamino]-2-oxoethyl]amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCC(=O)NCCOP(=O)(O)OP(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C23H31N3O11P2/c1-23(2,3)34-22(29)26-17-21(28)25-16-20(27)24-14-15-33-38(30,31)37-39(32,35-18-10-6-4-7-11-18)36-19-12-8-5-9-13-19/h4-13H,14-17H2,1-3H3,(H,24,27)(H,25,28)(H,26,29)(H,30,31) |
| InChIKey | NCYNMAKPYXZWHD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 187.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|