About 4-oxopent-2-en-2-yl diphenyl phosphate
4-oxopent-2-en-2-yl diphenyl phosphate (PubChem CID 71319134) has the molecular formula C17H17O5P
and a molecular weight of 332.29 g/mol. Its IUPAC name is 4-oxopent-2-en-2-yl diphenyl phosphate.
Molecular Properties
| Compound Name | 4-oxopent-2-en-2-yl diphenyl phosphate |
| PubChem CID | 71319134 |
| Molecular Formula | C17H17O5P |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 4-oxopent-2-en-2-yl diphenyl phosphate |
| SMILES | CC(=O)C=C(C)OP(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C17H17O5P/c1-14(18)13-15(2)20-23(19,21-16-9-5-3-6-10-16)22-17-11-7-4-8-12-17/h3-13H,1-2H3 |
| InChIKey | VZNJNQWWOKUSCO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-oxopent-2-en-2-yl diphenyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxopent-2-en-2-yl diphenyl phosphate?
The IUPAC name of 4-oxopent-2-en-2-yl diphenyl phosphate (CID 71319134) is 4-oxopent-2-en-2-yl diphenyl phosphate.
What is the SMILES notation for 4-oxopent-2-en-2-yl diphenyl phosphate?
The canonical SMILES for 4-oxopent-2-en-2-yl diphenyl phosphate is CC(=O)C=C(C)OP(=O)(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of 4-oxopent-2-en-2-yl diphenyl phosphate?
The InChIKey is VZNJNQWWOKUSCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17O5P/c1-14(18)13-15(2)20-23(19,21-16-9-5-3-6-10-16)22-17-11-7-4-8-12-17/h3-13H,1-2H3.
What are the key properties of 4-oxopent-2-en-2-yl diphenyl phosphate?
4-oxopent-2-en-2-yl diphenyl phosphate has a molecular weight of 332.29 g/mol, XLogP of 4.76, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxopent-2-en-2-yl diphenyl phosphate is sourced from PubChem (CID 71319134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).