About diphenoxyphosphoryl 4-ethylbenzoate
diphenoxyphosphoryl 4-ethylbenzoate (PubChem CID 175366295) has the molecular formula C21H19O5P
and a molecular weight of 382.35 g/mol. Its IUPAC name is diphenoxyphosphoryl 4-ethylbenzoate.
Molecular Properties
| Compound Name | diphenoxyphosphoryl 4-ethylbenzoate |
| PubChem CID | 175366295 |
| Molecular Formula | C21H19O5P |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | diphenoxyphosphoryl 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)OP(=O)(Oc2ccccc2)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C21H19O5P/c1-2-17-13-15-18(16-14-17)21(22)26-27(23,24-19-9-5-3-6-10-19)25-20-11-7-4-8-12-20/h3-16H,2H2,1H3 |
| InChIKey | QFXPDUSFQVYRAS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenoxyphosphoryl 4-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenoxyphosphoryl 4-ethylbenzoate?
The IUPAC name of diphenoxyphosphoryl 4-ethylbenzoate (CID 175366295) is diphenoxyphosphoryl 4-ethylbenzoate.
What is the SMILES notation for diphenoxyphosphoryl 4-ethylbenzoate?
The canonical SMILES for diphenoxyphosphoryl 4-ethylbenzoate is CCc1ccc(C(=O)OP(=O)(Oc2ccccc2)Oc2ccccc2)cc1.
What is the InChIKey of diphenoxyphosphoryl 4-ethylbenzoate?
The InChIKey is QFXPDUSFQVYRAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19O5P/c1-2-17-13-15-18(16-14-17)21(22)26-27(23,24-19-9-5-3-6-10-19)25-20-11-7-4-8-12-20/h3-16H,2H2,1H3.
What are the key properties of diphenoxyphosphoryl 4-ethylbenzoate?
diphenoxyphosphoryl 4-ethylbenzoate has a molecular weight of 382.35 g/mol, XLogP of 5.67, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diphenoxyphosphoryl 4-ethylbenzoate is sourced from PubChem (CID 175366295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).