C17H26BrNO5 — CID 177204963
1-bromo-3-methoxybenzene;tert-butyl N-[2-[(E)-2-hydroxyprop-1-enoxy]ethyl]carbamate (PubChem CID 177204963) has the molecular formula C17H26BrNO5 and a molecular weight of 404.30 g/mol. Its IUPAC name is 1-bromo-3-methoxybenzene;tert-butyl N-[2-[(E)-2-hydroxyprop-1-enoxy]ethyl]carbamate.
| Compound Name | 1-bromo-3-methoxybenzene;tert-butyl N-[2-[(E)-2-hydroxyprop-1-enoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 177204963 |
| Molecular Formula | C17H26BrNO5 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 1-bromo-3-methoxybenzene;tert-butyl N-[2-[(E)-2-hydroxyprop-1-enoxy]ethyl]carbamate |
| SMILES | C/C(O)=C\OCCNC(=O)OC(C)(C)C.COc1cccc(Br)c1 |
| InChI | InChI=1S/C10H19NO4.C7H7BrO/c1-8(12)7-14-6-5-11-9(13)15-10(2,3)4;1-9-7-4-2-3-6(8)5-7/h7,12H,5-6H2,1-4H3,(H,11,13);2-5H,1H3/b8-7+; |
| InChIKey | FZGSIALIFANKRB-USRGLUTNSA-N |
| XLogP | 4.40 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|