C22H28N2O5 — CID 46423513
tert-butyl N-[4-[2-[2-(3-methoxyphenoxy)ethylamino]-2-oxoethyl]phenyl]carbamate (PubChem CID 46423513) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[2-(3-methoxyphenoxy)ethylamino]-2-oxoethyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[2-(3-methoxyphenoxy)ethylamino]-2-oxoethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 46423513 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | tert-butyl N-[4-[2-[2-(3-methoxyphenoxy)ethylamino]-2-oxoethyl]phenyl]carbamate |
| SMILES | COc1cccc(OCCNC(=O)Cc2ccc(NC(=O)OC(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C22H28N2O5/c1-22(2,3)29-21(26)24-17-10-8-16(9-11-17)14-20(25)23-12-13-28-19-7-5-6-18(15-19)27-4/h5-11,15H,12-14H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | KZRBOKTWPRZRPI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|