C15H24FN2O4P — CID 138706289
[2-(6-aminohexylcarbamoyl)-4-(1-fluoroethyl)phenyl] dihydrogen phosphite (PubChem CID 138706289) has the molecular formula C15H24FN2O4P and a molecular weight of 346.34 g/mol. Its IUPAC name is [2-(6-aminohexylcarbamoyl)-4-(1-fluoroethyl)phenyl] dihydrogen phosphite.
| Compound Name | [2-(6-aminohexylcarbamoyl)-4-(1-fluoroethyl)phenyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 138706289 |
| Molecular Formula | C15H24FN2O4P |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | [2-(6-aminohexylcarbamoyl)-4-(1-fluoroethyl)phenyl] dihydrogen phosphite |
| SMILES | CC(F)c1ccc(OP(O)O)c(C(=O)NCCCCCCN)c1 |
| InChI | InChI=1S/C15H24FN2O4P/c1-11(16)12-6-7-14(22-23(20)21)13(10-12)15(19)18-9-5-3-2-4-8-17/h6-7,10-11,20-21H,2-5,8-9,17H2,1H3,(H,18,19) |
| InChIKey | JAKJETJPIWWCST-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|