C24H28N5O8PS — CID 123633728
[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]sulfanyl-[2-[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]ethoxy]phosphinic acid (PubChem CID 123633728) has the molecular formula C24H28N5O8PS and a molecular weight of 577.56 g/mol. Its IUPAC name is [3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]sulfanyl-[2-[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]ethoxy]phosphinic acid.
| Compound Name | [3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]sulfanyl-[2-[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]ethoxy]phosphinic acid |
|---|---|
| PubChem CID | 123633728 |
| Molecular Formula | C24H28N5O8PS |
| Molecular Weight | 577.56 g/mol |
| Exact Mass | 577.14 |
| IUPAC Name | [3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]sulfanyl-[2-[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]ethoxy]phosphinic acid |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(C(=O)NCCOP(=O)(O)SCCC(=O)On3c(O)ccc3O)cc2)cc1 |
| InChI | InChI=1S/C24H28N5O8PS/c1-28(2)20-9-7-19(8-10-20)27-26-18-5-3-17(4-6-18)24(33)25-14-15-36-38(34,35)39-16-13-23(32)37-29-21(30)11-12-22(29)31/h3-12,30-31H,13-16H2,1-2H3,(H,25,33)(H,34,35)/b27-26+ |
| InChIKey | DUSYSJIPHGISSJ-CYYJNZCTSA-N |
| XLogP | 4.01 |
| TPSA | 175.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.56 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|