C28H41N7O5 — CID 162431380
4-[[4-(dimethylamino)phenyl]diazenyl]-N-[2-[2-[2-[2-[4-(methoxymethyl)-3-methyl-2H-triazol-1-yl]ethoxy]ethoxy]ethoxy]ethyl]benzamide (PubChem CID 162431380) has the molecular formula C28H41N7O5 and a molecular weight of 555.68 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]diazenyl]-N-[2-[2-[2-[2-[4-(methoxymethyl)-3-methyl-2H-triazol-1-yl]ethoxy]ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | 4-[[4-(dimethylamino)phenyl]diazenyl]-N-[2-[2-[2-[2-[4-(methoxymethyl)-3-methyl-2H-triazol-1-yl]ethoxy]ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 162431380 |
| Molecular Formula | C28H41N7O5 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]diazenyl]-N-[2-[2-[2-[2-[4-(methoxymethyl)-3-methyl-2H-triazol-1-yl]ethoxy]ethoxy]ethoxy]ethyl]benzamide |
| SMILES | COCC1=CN(CCOCCOCCOCCNC(=O)c2ccc(/N=N/c3ccc(N(C)C)cc3)cc2)NN1C |
| InChI | InChI=1S/C28H41N7O5/c1-33(2)26-11-9-25(10-12-26)31-30-24-7-5-23(6-8-24)28(36)29-13-15-38-17-19-40-20-18-39-16-14-35-21-27(22-37-4)34(3)32-35/h5-12,21,32H,13-20,22H2,1-4H3,(H,29,36)/b31-30+ |
| InChIKey | ATCOQZYPKDTYLD-NVQSTNCTSA-N |
| XLogP | 3.10 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|