C30H44N5O11P — CID 59533127
[(2R)-3-[2-[3-[2-[2-[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]ethoxy]ethoxy]propanoylamino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] propanoate (PubChem CID 59533127) has the molecular formula C30H44N5O11P and a molecular weight of 681.68 g/mol. Its IUPAC name is [(2R)-3-[2-[3-[2-[2-[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]ethoxy]ethoxy]propanoylamino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] propanoate.
| Compound Name | [(2R)-3-[2-[3-[2-[2-[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]ethoxy]ethoxy]propanoylamino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] propanoate |
|---|---|
| PubChem CID | 59533127 |
| Molecular Formula | C30H44N5O11P |
| Molecular Weight | 681.68 g/mol |
| Exact Mass | 681.28 |
| IUPAC Name | [(2R)-3-[2-[3-[2-[2-[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]ethoxy]ethoxy]propanoylamino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] propanoate |
| SMILES | CCC(=O)OC[C@@H](O)COP(=O)(O)OCCNC(=O)CCOCCOCCNC(=O)c1ccc(/N=N/c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H44N5O11P/c1-4-29(38)44-21-27(36)22-46-47(40,41)45-18-15-31-28(37)13-16-42-19-20-43-17-14-32-30(39)23-5-7-24(8-6-23)33-34-25-9-11-26(12-10-25)35(2)3/h5-12,27,36H,4,13-22H2,1-3H3,(H,31,37)(H,32,39)(H,40,41)/b34-33+/t27-/m1/s1 |
| InChIKey | FCCDMWPDNKFOAY-YJFLJSCQSA-N |
| XLogP | 2.88 |
| TPSA | 206.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.68 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|