C28H52NO8P — CID 165202630
[2-hydroxy-3-[hydroxy-[2-[[(11Z,14Z)-icosa-11,14-dienoyl]amino]ethoxy]phosphoryl]oxypropyl] propanoate (PubChem CID 165202630) has the molecular formula C28H52NO8P and a molecular weight of 561.70 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy-[2-[[(11Z,14Z)-icosa-11,14-dienoyl]amino]ethoxy]phosphoryl]oxypropyl] propanoate.
| Compound Name | [2-hydroxy-3-[hydroxy-[2-[[(11Z,14Z)-icosa-11,14-dienoyl]amino]ethoxy]phosphoryl]oxypropyl] propanoate |
|---|---|
| PubChem CID | 165202630 |
| Molecular Formula | C28H52NO8P |
| Molecular Weight | 561.70 g/mol |
| Exact Mass | 561.34 |
| IUPAC Name | [2-hydroxy-3-[hydroxy-[2-[[(11Z,14Z)-icosa-11,14-dienoyl]amino]ethoxy]phosphoryl]oxypropyl] propanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)NCCOP(=O)(O)OCC(O)COC(=O)CC |
| InChI | InChI=1S/C28H52NO8P/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-27(31)29-22-23-36-38(33,34)37-25-26(30)24-35-28(32)4-2/h8-9,11-12,26,30H,3-7,10,13-25H2,1-2H3,(H,29,31)(H,33,34)/b9-8-,12-11- |
| InChIKey | DJAYOZLUTGFUIZ-MURFETPASA-N |
| XLogP | 6.14 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.70 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|