C25H46NO8P — CID 165194066
[3-[2-[[(9Z,12Z)-heptadeca-9,12-dienoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] propanoate (PubChem CID 165194066) has the molecular formula C25H46NO8P and a molecular weight of 519.62 g/mol. Its IUPAC name is [3-[2-[[(9Z,12Z)-heptadeca-9,12-dienoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] propanoate.
| Compound Name | [3-[2-[[(9Z,12Z)-heptadeca-9,12-dienoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] propanoate |
|---|---|
| PubChem CID | 165194066 |
| Molecular Formula | C25H46NO8P |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.30 |
| IUPAC Name | [3-[2-[[(9Z,12Z)-heptadeca-9,12-dienoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] propanoate |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCC(=O)NCCOP(=O)(O)OCC(O)COC(=O)CC |
| InChI | InChI=1S/C25H46NO8P/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24(28)26-19-20-33-35(30,31)34-22-23(27)21-32-25(29)4-2/h7-8,10-11,23,27H,3-6,9,12-22H2,1-2H3,(H,26,28)(H,30,31)/b8-7-,11-10- |
| InChIKey | CBLZYWZMHWGJIB-NQLNTKRDSA-N |
| XLogP | 4.97 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|