C41H74NO8P — CID 165234305
[3-[2-[[(9Z,12Z)-heptadeca-9,12-dienoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (9Z,12Z)-nonadeca-9,12-dienoate (PubChem CID 165234305) has the molecular formula C41H74NO8P and a molecular weight of 740.02 g/mol. Its IUPAC name is [3-[2-[[(9Z,12Z)-heptadeca-9,12-dienoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (9Z,12Z)-nonadeca-9,12-dienoate.
| Compound Name | [3-[2-[[(9Z,12Z)-heptadeca-9,12-dienoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (9Z,12Z)-nonadeca-9,12-dienoate |
|---|---|
| PubChem CID | 165234305 |
| Molecular Formula | C41H74NO8P |
| Molecular Weight | 740.02 g/mol |
| Exact Mass | 739.52 |
| IUPAC Name | [3-[2-[[(9Z,12Z)-heptadeca-9,12-dienoyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (9Z,12Z)-nonadeca-9,12-dienoate |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCC(=O)NCCOP(=O)(O)OCC(O)COC(=O)CCCCCCC/C=C\C/C=C\CCCCCC |
| InChI | InChI=1S/C41H74NO8P/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-34-41(45)48-37-39(43)38-50-51(46,47)49-36-35-42-40(44)33-31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h10,12-13,15-16,18-20,39,43H,3-9,11,14,17,21-38H2,1-2H3,(H,42,44)(H,46,47)/b12-10-,15-13-,18-16-,20-19- |
| InChIKey | JFJZIPDNXVWSDC-YGVRUMBCSA-N |
| XLogP | 10.77 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.02 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|