C29H54NO8P — CID 165243011
[3-[2-(heptanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (9Z,12Z)-heptadeca-9,12-dienoate (PubChem CID 165243011) has the molecular formula C29H54NO8P and a molecular weight of 575.72 g/mol. Its IUPAC name is [3-[2-(heptanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (9Z,12Z)-heptadeca-9,12-dienoate.
| Compound Name | [3-[2-(heptanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (9Z,12Z)-heptadeca-9,12-dienoate |
|---|---|
| PubChem CID | 165243011 |
| Molecular Formula | C29H54NO8P |
| Molecular Weight | 575.72 g/mol |
| Exact Mass | 575.36 |
| IUPAC Name | [3-[2-(heptanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (9Z,12Z)-heptadeca-9,12-dienoate |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(O)COP(=O)(O)OCCNC(=O)CCCCCC |
| InChI | InChI=1S/C29H54NO8P/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-20-22-29(33)36-25-27(31)26-38-39(34,35)37-24-23-30-28(32)21-19-8-6-4-2/h9-10,12-13,27,31H,3-8,11,14-26H2,1-2H3,(H,30,32)(H,34,35)/b10-9-,13-12- |
| InChIKey | KNRRYCZPFCHHES-UTJQPWESSA-N |
| XLogP | 6.53 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.72 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|